|
CAS#: 752980-83-9 Product: Methyl (1R,2S)-2-amino-4-methylenecyclopentanecarboxylate No suppilers available for the product. |
| Name | Methyl (1R,2S)-2-amino-4-methylenecyclopentanecarboxylate |
|---|---|
| Synonyms | (1R,2S)-methyl 2-amino-4-methylenecyclopentanecarboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.19 |
| CAS Registry Number | 752980-83-9 |
| SMILES | COC(=O)[C@@H]1CC(=C)C[C@@H]1N |
| InChI | 1S/C8H13NO2/c1-5-3-6(7(9)4-5)8(10)11-2/h6-7H,1,3-4,9H2,2H3/t6-,7+/m1/s1 |
| InChIKey | XWLSBUHERZZWCM-RQJHMYQMSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 209.3±40.0°C at 760 mmHg (Cal.) |
| Flash point | 78.8±24.9°C (Cal.) |
| Refractive index | 1.488 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (1R,2S)-2-amino-4-methylenecyclopentanecarboxylate |