|
CAS#: 7535-48-0 Product: 4',5'-Dihydropsoralen No suppilers available for the product. |
| Name | 4',5'-Dihydropsoralen |
|---|---|
| Synonyms | 4',5'-Dihydropsoralen; 7H-Furo(3,2-G)(1)Benzopyran-7-One, 2,3-Dihydro- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H8O3 |
| Molecular Weight | 188.18 |
| CAS Registry Number | 7535-48-0 |
| SMILES | C2=C1OCCC1=CC3=C2OC(=O)C=C3 |
| InChI | 1S/C11H8O3/c12-11-2-1-7-5-8-3-4-13-9(8)6-10(7)14-11/h1-2,5-6H,3-4H2 |
| InChIKey | VXGRJERITKFWPL-UHFFFAOYSA-N |
| Density | 1.371g/cm3 (Cal.) |
|---|---|
| Boiling point | 371.272°C at 760 mmHg (Cal.) |
| Flash point | 155.562°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4',5'-Dihydropsoralen |