|
CAS#: 75476-80-1 Product: 6-Nitro-1H-Indene No suppilers available for the product. |
| Name | 6-Nitro-1H-Indene |
|---|---|
| Synonyms | 6-Nitroindene; Brn 4391066; Ccris 5514 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.16 |
| CAS Registry Number | 75476-80-1 |
| SMILES | C2=CC1=C(CC=C1)C=C2[N+]([O-])=O |
| InChI | 1S/C9H7NO2/c11-10(12)9-5-4-7-2-1-3-8(7)6-9/h1-2,4-6H,3H2 |
| InChIKey | UJHGOFSFBKXJNM-UHFFFAOYSA-N |
| Density | 1.303g/cm3 (Cal.) |
|---|---|
| Boiling point | 283.415°C at 760 mmHg (Cal.) |
| Flash point | 136.864°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Nitro-1H-Indene |