|
CAS#: 75535-12-5 Product: 1,2-Bis(2,3-Dimethylphenyl)Guanidine No suppilers available for the product. |
| Name | 1,2-Bis(2,3-Dimethylphenyl)Guanidine |
|---|---|
| Synonyms | Guanidine, N,N'-Bis(Dimethylphenyl)-; N,N'-Bis(Dimethylphenyl)Guanidine |
| Molecular Structure | ![]() |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.37 |
| CAS Registry Number | 75535-12-5 |
| EINECS | 278-247-0 |
| SMILES | C2=C(NC(=NC1=CC=CC(=C1C)C)N)C(=C(C=C2)C)C |
| InChI | 1S/C17H21N3/c1-11-7-5-9-15(13(11)3)19-17(18)20-16-10-6-8-12(2)14(16)4/h5-10H,1-4H3,(H3,18,19,20) |
| InChIKey | SQDYIZWEQGMDFO-UHFFFAOYSA-N |
| Density | 1.061g/cm3 (Cal.) |
|---|---|
| Boiling point | 440.085°C at 760 mmHg (Cal.) |
| Flash point | 219.956°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Bis(2,3-Dimethylphenyl)Guanidine |