|
CAS#: 75596-72-4 Product: (2S)-5-Amino-2-[(4-Hydroxyphenyl)-Methylamino]-5-Oxopentanoic Acid No suppilers available for the product. |
| Name | (2S)-5-Amino-2-[(4-Hydroxyphenyl)-Methylamino]-5-Oxopentanoic Acid |
|---|---|
| Synonyms | (2S)-5-Amino-2-[(4-Hydroxyphenyl)-Methyl-Amino]-5-Oxo-Pentanoic Acid; (2S)-5-Amino-2-[(4-Hydroxyphenyl)-Methyl-Amino]-5-Keto-Valeric Acid; L-Glutamine, N-(4-Hydroxyphenyl)-N-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 |
| CAS Registry Number | 75596-72-4 |
| SMILES | [C@H](C(=O)O)(N(C)C1=CC=C(C=C1)O)CCC(=O)N |
| InChI | 1S/C12H16N2O4/c1-14(8-2-4-9(15)5-3-8)10(12(17)18)6-7-11(13)16/h2-5,10,15H,6-7H2,1H3,(H2,13,16)(H,17,18)/t10-/m0/s1 |
| InChIKey | LJEQJKDRBQGIOF-JTQLQIEISA-N |
| Density | 1.344g/cm3 (Cal.) |
|---|---|
| Boiling point | 594.668°C at 760 mmHg (Cal.) |
| Flash point | 313.444°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S)-5-Amino-2-[(4-Hydroxyphenyl)-Methylamino]-5-Oxopentanoic Acid |