Online Database of Chemicals from Around the World
|
CAS#: 756-91-2 Product: (E)-1,1,1,7,7,7-Hexafluoro-4-Methyl-2,6-Bis(Trifluoromethyl)Hept-3-Ene -2,6-Diol No suppilers available for the product. |
| Name | (E)-1,1,1,7,7,7-Hexafluoro-4-Methyl-2,6-Bis(Trifluoromethyl)Hept-3-Ene -2,6-Diol |
|---|---|
| Synonyms | 3-Penten-1,5-Diol, 3-Methyl-1,1,5,5-Tetrakis(Trifluoromethyl)-; Acd-10614 |
| Molecular Structure |  |
| Molecular Formula | C10H8F12O2 |
| Molecular Weight | 388.15 |
| CAS Registry Number | 756-91-2 |
| SMILES | C(C(O)(C(F)(F)F)C(F)(F)F)/C(=C/C(O)(C(F)(F)F)C(F)(F)F)C |
| InChI | 1S/C10H8F12O2/c1-4(2-5(23,7(11,12)13)8(14,15)16)3-6(24,9(17,18)19)10(20,21)22/h2,23-24H,3H2,1H3/b4-2+ |
| InChIKey | PTHJGFDUQRGSRD-DUXPYHPUSA-N |
| Density | 1.567g/cm3 (Cal.) |
|---|---|
| Boiling point | 292.14°C at 760 mmHg (Cal.) |
| Flash point | 130.482°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (E)-1,1,1,7,7,7-Hexafluoro-4-Methyl-2,6-Bis(Trifluoromethyl)Hept-3-Ene -2,6-Diol |