|
CAS#: 75645-15-7 Product: alpha-Chlorohydrin Mono-4-Acetamidobenzoate No suppilers available for the product. |
| Name | alpha-Chlorohydrin Mono-4-Acetamidobenzoate |
|---|---|
| Synonyms | (3-Chloro-2-Hydroxy-Propyl) 4-Acetamidobenzoate; 4-Acetamidobenzoic Acid (3-Chloro-2-Hydroxypropyl) Ester; 4-Acetamidobenzoic Acid (3-Chloro-2-Hydroxy-Propyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14ClNO4 |
| Molecular Weight | 271.70 |
| CAS Registry Number | 75645-15-7 |
| SMILES | C1=C(C=CC(=C1)NC(C)=O)C(OCC(CCl)O)=O |
| InChI | 1S/C12H14ClNO4/c1-8(15)14-10-4-2-9(3-5-10)12(17)18-7-11(16)6-13/h2-5,11,16H,6-7H2,1H3,(H,14,15) |
| InChIKey | XOEKQGPIEBPNEV-UHFFFAOYSA-N |
| Density | 1.34g/cm3 (Cal.) |
|---|---|
| Boiling point | 524.849°C at 760 mmHg (Cal.) |
| Flash point | 271.219°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-Chlorohydrin Mono-4-Acetamidobenzoate |