|
CAS#: 7570-86-7 Product: trans-1,3-Diphenyl-2,3-Epoxypropan-1-One No suppilers available for the product. |
| Name | trans-1,3-Diphenyl-2,3-Epoxypropan-1-One |
|---|---|
| Synonyms | Phenyl-(3-Phenyl-2-Oxiranyl)Methanone; Nsc 10919; Nsc10919 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12O2 |
| Molecular Weight | 224.26 |
| CAS Registry Number | 7570-86-7 |
| SMILES | C1=CC=CC(=C1)C2OC2C(C3=CC=CC=C3)=O |
| InChI | 1S/C15H12O2/c16-13(11-7-3-1-4-8-11)15-14(17-15)12-9-5-2-6-10-12/h1-10,14-15H |
| InChIKey | UQGMJZQVDNZRKT-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 88-90°C (Expl.) |
| Boiling point | 374.1±42.0°C at 760 mmHg (Cal.) |
| Flash point | 174.0±21.4°C (Cal.) |
| Safety Code | S26;S37 Details |
|---|---|
| Risk Code | R36/37/38 Details |
| Hazard Symbol | X Details |
| Safety Description | WARNING: Irritates lungs, eyes, skin |
| IRRITANT | |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for trans-1,3-Diphenyl-2,3-Epoxypropan-1-One |