Online Database of Chemicals from Around the World
|
CAS#: 75762-43-5 Product: 1,1'-[1,3-Propanediylbis(oxy)]bis(2,4-dinitrobenzene) No suppilers available for the product. |
| Name | 1,1'-[1,3-Propanediylbis(oxy)]bis(2,4-dinitrobenzene) |
|---|---|
| Synonyms | 1,1'-[propane-1,3-diylbis(oxy)]bis[2,4-dinitrobenzene] |
| Molecular Structure | ![CAS#: 75762-43-5, 1,1'-[1,3-Propanediylbis(oxy)]bis(2,4-dinitrobenzene)](/moreStructures/75762-43-5.gif) |
| Molecular Formula | C15H12N4O10 |
| Molecular Weight | 408.28 |
| CAS Registry Number | 75762-43-5 |
| EINECS | 278-303-4 |
| SMILES | O=N(=O)c2ccc(OCCCOc1ccc(cc1N(=O)=O)N(=O)=O)c(c2)N(=O)=O |
| InChI | 1S/C15H12N4O10/c20-16(21)10-2-4-14(12(8-10)18(24)25)28-6-1-7-29-15-5-3-11(17(22)23)9-13(15)19(26)27/h2-5,8-9H,1,6-7H2 |
| InChIKey | IXBVTQBLDYIPSB-UHFFFAOYSA-N |
| Density | 1.557g/cm3 (Cal.) |
|---|---|
| Boiling point | 635.049°C at 760 mmHg (Cal.) |
| Flash point | 277.135°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-[1,3-Propanediylbis(oxy)]bis(2,4-dinitrobenzene) |