Online Database of Chemicals from Around the World
|
CAS#: 75790-83-9 Product: 5-[(4-Aminophenyl)Methyl]-2-Methylaniline No suppilers available for the product. |
| Name | 5-[(4-Aminophenyl)Methyl]-2-Methylaniline |
|---|---|
| Synonyms | 5-[(4-Aminophenyl)Methyl]-2-Methyl-Aniline; [5-(4-Aminobenzyl)-2-Methyl-Phenyl]Amine; 3,4'-Diamino-4-Methyldiphenylmethane |
| Molecular Structure | ![CAS#: 75790-83-9, 5-[(4-Aminophenyl)Methyl]-2-Methylaniline](/moreStructures/75790-83-9.gif) |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.29 |
| CAS Registry Number | 75790-83-9 |
| EINECS | 278-311-8 |
| SMILES | C1=CC(=CC(=C1C)N)CC2=CC=C(C=C2)N |
| InChI | 1S/C14H16N2/c1-10-2-3-12(9-14(10)16)8-11-4-6-13(15)7-5-11/h2-7,9H,8,15-16H2,1H3 |
| InChIKey | ZZWIUWXGJRSQIR-UHFFFAOYSA-N |
| Density | 1.119g/cm3 (Cal.) |
|---|---|
| Boiling point | 402.224°C at 760 mmHg (Cal.) |
| Flash point | 235.674°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-[(4-Aminophenyl)Methyl]-2-Methylaniline |