|
CAS#: 7583-84-8 Product: cis-2-Piperidinocyclohexan-1-Ol No suppilers available for the product. |
| Name | cis-2-Piperidinocyclohexan-1-Ol |
|---|---|
| Synonyms | (1S,2R)-2-(1-Piperidyl)Cyclohexan-1-Ol; (1S,2R)-2-(1-Piperidyl)-1-Cyclohexanol; (1S,2R)-2-Piperidinocyclohexan-1-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 |
| CAS Registry Number | 7583-84-8 |
| EINECS | 231-490-6 |
| SMILES | [C@H]2(N1CCCCC1)[C@@H](O)CCCC2 |
| InChI | 1S/C11H21NO/c13-11-7-3-2-6-10(11)12-8-4-1-5-9-12/h10-11,13H,1-9H2/t10-,11+/m1/s1 |
| InChIKey | UXCABTUQGBBPPF-MNOVXSKESA-N |
| Density | 1.05g/cm3 (Cal.) |
|---|---|
| Boiling point | 281.492°C at 760 mmHg (Cal.) |
| Flash point | 79.773°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for cis-2-Piperidinocyclohexan-1-Ol |