|
CAS#: 75853-44-0 Product: (9-Amino-6-Chloroacridin-2-Yl) Dihydrogen Phosphate No suppilers available for the product. |
| Name | (9-Amino-6-Chloroacridin-2-Yl) Dihydrogen Phosphate |
|---|---|
| Synonyms | (9-Amino-6-Chloro-Acridin-2-Yl) Dihydrogen Phosphate; (9-Amino-6-Chloro-2-Acridinyl) Dihydrogen Phosphate; 9-Amino-6-Chloroacridine-2-Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10ClN2O4P |
| Molecular Weight | 324.66 |
| CAS Registry Number | 75853-44-0 |
| SMILES | C1=C3C(=CC=C1O[P](=O)(O)O)N=C2C=C(C=CC2=C3N)Cl |
| InChI | 1S/C13H10ClN2O4P/c14-7-1-3-9-12(5-7)16-11-4-2-8(20-21(17,18)19)6-10(11)13(9)15/h1-6H,(H2,15,16)(H2,17,18,19) |
| InChIKey | OWFHEUBYDGJHQL-UHFFFAOYSA-N |
| Density | 1.693g/cm3 (Cal.) |
|---|---|
| Boiling point | 639.52°C at 760 mmHg (Cal.) |
| Flash point | 340.57°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (9-Amino-6-Chloroacridin-2-Yl) Dihydrogen Phosphate |