|
CAS#: 75908-77-9 Product: 2,6-Dichloro-4-(2-Methylbutan-2-Yl)Phenol No suppilers available for the product. |
| Name | 2,6-Dichloro-4-(2-Methylbutan-2-Yl)Phenol |
|---|---|
| Synonyms | 2,6-Dichloro-4-(1,1-Dimethylpropyl)Phenol; 4-Tert-Amyl-2,6-Dichloro-Phenol; Phenol, 2,6-Dichloro-4-(1,1-Dimethylpropyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14Cl2O |
| Molecular Weight | 233.14 |
| CAS Registry Number | 75908-77-9 |
| SMILES | C1=C(C(CC)(C)C)C=C(Cl)C(=C1Cl)O |
| InChI | 1S/C11H14Cl2O/c1-4-11(2,3)7-5-8(12)10(14)9(13)6-7/h5-6,14H,4H2,1-3H3 |
| InChIKey | PNVAMJAIDPAKST-UHFFFAOYSA-N |
| Density | 1.196g/cm3 (Cal.) |
|---|---|
| Boiling point | 262.512°C at 760 mmHg (Cal.) |
| Flash point | 113.404°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Dichloro-4-(2-Methylbutan-2-Yl)Phenol |