|
CAS#: 75975-83-6 Product: Caryophyllene, acetylated No suppilers available for the product. |
| Name | Caryophyllene, acetylated |
|---|---|
| Synonyms | Acetyl Acetate; (1R,4Z,9S)-4,11,11-Trimethyl-8-Methylene-Bicyclo[7.2.0]Undec-4-Ene; Acetic Acid Acetyl Ester; (1R,4Z,9S)-4,11,11-Trimethyl-8-Methylenebicyclo[7.2.0]Undec-4-Ene; Acetic Acid Acetyl Ester; (1R,4Z,9S)-4,11,11-Trimethyl-8-Methylene-Bicyclo[7.2.0]Undec-4-Ene |
| Molecular Structure | ![]() |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.44 |
| CAS Registry Number | 75975-83-6 |
| SMILES | [C@@H]12[C@H](CC1(C)C)C(CC/C=C(CC2)/C)=C.CC(OC(=O)C)=O |
| InChI | 1S/C15H24.C4H6O3/c1-11-6-5-7-12(2)13-10-15(3,4)14(13)9-8-11;1-3(5)7-4(2)6/h6,13-14H,2,5,7-10H2,1,3-4H3;1-2H3/b11-6-;/t13-,14-;/m1./s1 |
| InChIKey | DWYHUKSMKNWPGU-ZTDCGIRDSA-N |
| Boiling point | 268.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 104.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Caryophyllene, acetylated |