|
CAS#: 7605-55-2 Product: Methyl cis-2-Methylcyclohexanecarboxylate No suppilers available for the product. |
| Name | Methyl cis-2-Methylcyclohexanecarboxylate |
|---|---|
| Synonyms | (1R,2S)-2-Methyl-1-Cyclohexanecarboxylic Acid Methyl Ester; (1R,2S)-2-Methylcyclohexane-1-Carboxylic Acid Methyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 |
| CAS Registry Number | 7605-55-2 |
| EINECS | 231-518-7 |
| SMILES | [C@H]1(C(=O)OC)[C@@H](C)CCCC1 |
| InChI | 1S/C9H16O2/c1-7-5-3-4-6-8(7)9(10)11-2/h7-8H,3-6H2,1-2H3/t7-,8+/m0/s1 |
| InChIKey | OKLPIZJSDADMHA-JGVFFNPUSA-N |
| Density | 0.952g/cm3 (Cal.) |
|---|---|
| Boiling point | 191.678°C at 760 mmHg (Cal.) |
| Flash point | 66.324°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl cis-2-Methylcyclohexanecarboxylate |