|
CAS#: 761-02-4 Product: Triethylammonium Sulphamate No suppilers available for the product. |
| Name | Triethylammonium Sulphamate |
|---|---|
| Synonyms | Sulfamic Acid; Triethylamine; Triethylamine Sulfamate; Triethylammonium Sulphamate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H18N2O3S |
| Molecular Weight | 198.28 |
| CAS Registry Number | 761-02-4 |
| EINECS | 212-087-4 |
| SMILES | O=[S](=O)(O)N.C(N(CC)CC)C |
| InChI | 1S/C6H15N.H3NO3S/c1-4-7(5-2)6-3;1-5(2,3)4/h4-6H2,1-3H3;(H3,1,2,3,4) |
| InChIKey | DQMFXGQHSPWNOA-UHFFFAOYSA-N |
| Boiling point | 90.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 152.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Triethylammonium Sulphamate |