|
CAS#: 761386-09-8 Product: Methyl (1R,3S)-3-aminocyclohexanecarboxylate No suppilers available for the product. |
| Name | Methyl (1R,3S)-3-aminocyclohexanecarboxylate |
|---|---|
| Synonyms | (1R,3S)-methyl 3-aminocyclohexanecarboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 |
| CAS Registry Number | 761386-09-8 |
| SMILES | COC(=O)[C@@H]1CCC[C@@H](C1)N |
| InChI | 1S/C8H15NO2/c1-11-8(10)6-3-2-4-7(9)5-6/h6-7H,2-5,9H2,1H3/t6-,7+/m1/s1 |
| InChIKey | ZMMITUCIAZVHCG-RQJHMYQMSA-N |
| Density | 1.037g/cm3 (Cal.) |
|---|---|
| Boiling point | 215.737°C at 760 mmHg (Cal.) |
| Flash point | 84.541°C (Cal.) |
| Refractive index | 1.468 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (1R,3S)-3-aminocyclohexanecarboxylate |