|
CAS#: 76174-21-5 Product: 3-Amino-2,5,9-Trimethylfuro[3,2-g]Chromen-7-One No suppilers available for the product. |
| Name | 3-Amino-2,5,9-Trimethylfuro[3,2-g]Chromen-7-One |
|---|---|
| Synonyms | 3-Amino-2,5,9-Trimethyl-Furo[3,2-G]Chromen-7-One; 3-Amino-2,5,9-Trimethyl-7-Furo[3,2-G]Chromenone; 3-Amino-2,5,9-Trimethyl-7H-Furo(3,2-G)(1)Benzopyran-7-One |
| Molecular Structure | ![]() |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.26 |
| CAS Registry Number | 76174-21-5 |
| SMILES | C1=C3C(=C(C2=C1C(=C(O2)C)N)C)OC(=O)C=C3C |
| InChI | 1S/C14H13NO3/c1-6-4-11(16)18-13-7(2)14-10(5-9(6)13)12(15)8(3)17-14/h4-5H,15H2,1-3H3 |
| InChIKey | SHAWIOMFPJAUQZ-UHFFFAOYSA-N |
| Density | 1.302g/cm3 (Cal.) |
|---|---|
| Boiling point | 456.427°C at 760 mmHg (Cal.) |
| Flash point | 229.839°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Amino-2,5,9-Trimethylfuro[3,2-g]Chromen-7-One |