|
CAS#: 76203-96-8 Product: Ethoxy-Methyl-Sulfanylidene-(2,4,6-Trichlorophenoxy)Phosphorane No suppilers available for the product. |
| Name | Ethoxy-Methyl-Sulfanylidene-(2,4,6-Trichlorophenoxy)Phosphorane |
|---|---|
| Synonyms | Ethoxy-Methyl-Thioxo-(2,4,6-Trichlorophenoxy)Phosphorane; O-(2,4,6-Trichlorophenyl) O-Ethyl Methylphosphonothioate; Oms 156 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H10Cl3O2PS |
| Molecular Weight | 319.57 |
| CAS Registry Number | 76203-96-8 |
| SMILES | C1=C(C(=C(C=C1Cl)Cl)O[P](C)(OCC)=S)Cl |
| InChI | 1S/C9H10Cl3O2PS/c1-3-13-15(2,16)14-9-7(11)4-6(10)5-8(9)12/h4-5H,3H2,1-2H3 |
| InChIKey | JQQMCGBSCREMEE-UHFFFAOYSA-N |
| Density | 1.448g/cm3 (Cal.) |
|---|---|
| Boiling point | 356.17°C at 760 mmHg (Cal.) |
| Flash point | 169.206°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethoxy-Methyl-Sulfanylidene-(2,4,6-Trichlorophenoxy)Phosphorane |