|
CAS#: 76217-33-9 Product: 2-[3-(3-Methoxyphenyl)-1,2,4-Triazol-1-Yl]Benzaldehyde No suppilers available for the product. |
| Name | 2-[3-(3-Methoxyphenyl)-1,2,4-Triazol-1-Yl]Benzaldehyde |
|---|---|
| Synonyms | 2-(3-(3-Methoxyphenyl)-S-Triazol-5-Yl)Benzaldehyde; Benzaldehyde, O-(5-(M-Methoxyphenyl)-S-Triazol-3-Yl)-; Brn 5569487 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.30 |
| CAS Registry Number | 76217-33-9 |
| SMILES | C1=CC=CC(=C1[N]2N=C(N=C2)C3=CC=CC(=C3)OC)C=O |
| InChI | 1S/C16H13N3O2/c1-21-14-7-4-6-12(9-14)16-17-11-19(18-16)15-8-3-2-5-13(15)10-20/h2-11H,1H3 |
| InChIKey | OLESXLRHLYXRKZ-UHFFFAOYSA-N |
| Density | 1.226g/cm3 (Cal.) |
|---|---|
| Boiling point | 513.994°C at 760 mmHg (Cal.) |
| Flash point | 264.654°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[3-(3-Methoxyphenyl)-1,2,4-Triazol-1-Yl]Benzaldehyde |