Online Database of Chemicals from Around the World
|
CAS#: 76234-43-0 Product: 11,17-Dihydroxy-3,20-dioxopregn-4-en-21-yl 5-oxo-L-prolinate No suppilers available for the product. |
| Name | 11,17-Dihydroxy-3,20-dioxopregn-4-en-21-yl 5-oxo-L-prolinate |
|---|---|
| Synonyms | 11β,17-di |
| Molecular Structure |  |
| Molecular Formula | C26H35NO7 |
| Molecular Weight | 473.56 |
| CAS Registry Number | 76234-43-0 |
| EINECS | 278-395-6 |
| SMILES | O=C(OCC(=O)[C@@]3(O)CC[C@H]2[C@@H]4CCC1=CC(=O)CC[C@]1(C)[C@H]4[C@@H](O)C[C@@]23C)[C@@H]5CCC(=O)N5 |
| InChI | 1S/C26H35NO7/c1-24-9-7-15(28)11-14(24)3-4-16-17-8-10-26(33,25(17,2)12-19(29)22(16)24)20(30)13-34-23(32)18-5-6-21(31)27-18/h11,16-19,22,29,33H,3-10,12-13H2,1-2H3,(H,27,31)/t16-,17-,18-,19-,22+,24-,25-,26-/m0/s1 |
| InChIKey | OJUIYOJRJPVMNW-XNLKTXQHSA-N |
| Density | 1.339g/cm3 (Cal.) |
|---|---|
| Boiling point | 716.545°C at 760 mmHg (Cal.) |
| Flash point | 387.152°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 11,17-Dihydroxy-3,20-dioxopregn-4-en-21-yl 5-oxo-L-prolinate |