|
CAS#: 76266-34-7 Product: 1-Carbamoyl-3,3-Dimethyl-1-(2-Methylphenyl)Urea No suppilers available for the product. |
| Name | 1-Carbamoyl-3,3-Dimethyl-1-(2-Methylphenyl)Urea |
|---|---|
| Synonyms | 1-Aminocarbonyl-3,3-Dimethyl-1-(2-Methylphenyl)Urea; 1,1,3-Trimethyl-5-Phenylbiuret; Imidodicarbonic Diamide, N,N,2-Trimethyl-N-Phenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 |
| CAS Registry Number | 76266-34-7 |
| SMILES | C1=C(N(C(=O)N(C)C)C(=O)N)C(=CC=C1)C |
| InChI | 1S/C11H15N3O2/c1-8-6-4-5-7-9(8)14(10(12)15)11(16)13(2)3/h4-7H,1-3H3,(H2,12,15) |
| InChIKey | VQBLMDMWEQYWBX-UHFFFAOYSA-N |
| Density | 1.216g/cm3 (Cal.) |
|---|---|
| Boiling point | 341.552°C at 760 mmHg (Cal.) |
| Flash point | 160.365°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Carbamoyl-3,3-Dimethyl-1-(2-Methylphenyl)Urea |