|
CAS#: 763-25-7 Product: Ethylene Glycol Bisphosphate No suppilers available for the product. |
| Name | Ethylene Glycol Bisphosphate |
|---|---|
| Synonyms | 1,2-Ethanediol, Bis(Dihydrogen Phosphate); Ethylene Glycol Bisphosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C2H8O8P2 |
| Molecular Weight | 222.03 |
| CAS Registry Number | 763-25-7 |
| SMILES | C(CO[P](=O)(O)O)O[P](=O)(O)O |
| InChI | 1S/C2H8O8P2/c3-11(4,5)9-1-2-10-12(6,7)8/h1-2H2,(H2,3,4,5)(H2,6,7,8) |
| InChIKey | ZYQRJZOMRGLPMK-UHFFFAOYSA-N |
| Density | 1.972g/cm3 (Cal.) |
|---|---|
| Boiling point | 538.846°C at 760 mmHg (Cal.) |
| Flash point | 279.684°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethylene Glycol Bisphosphate |