|
CAS#: 76393-30-1 Product: 1-(2-Chlorophenyl)-3-(2-Fluorophenyl)Urea No suppilers available for the product. |
| Name | 1-(2-Chlorophenyl)-3-(2-Fluorophenyl)Urea |
|---|---|
| Synonyms | Nsc164112; Urea, N-(2-Chlorophenyl)-N'-(2-Fluorophenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10ClFN2O |
| Molecular Weight | 264.69 |
| CAS Registry Number | 76393-30-1 |
| SMILES | C1=CC=CC(=C1NC(NC2=C(C=CC=C2)Cl)=O)F |
| InChI | 1S/C13H10ClFN2O/c14-9-5-1-3-7-11(9)16-13(18)17-12-8-4-2-6-10(12)15/h1-8H,(H2,16,17,18) |
| InChIKey | ULGYHDOPHWXLIF-UHFFFAOYSA-N |
| Density | 1.423g/cm3 (Cal.) |
|---|---|
| Boiling point | 281.286°C at 760 mmHg (Cal.) |
| Flash point | 123.918°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Chlorophenyl)-3-(2-Fluorophenyl)Urea |