|
CAS#: 76410-25-8 Product: 2-(4-Methoxyphenyl)-1-Phenyl-6,7-Dihydro-5H-Indol-4-One No suppilers available for the product. |
| Name | 2-(4-Methoxyphenyl)-1-Phenyl-6,7-Dihydro-5H-Indol-4-One |
|---|---|
| Synonyms | 1,5,6,7-Tetrahydro-2-(P-Methoxyphenyl)-1-Phenyl-4H-Indol-4-One; 1-Phenyl-2-P-Methoxyphenyl-4-Oxo-4,5,6,7-Tetrahydroindole; 4H-Indol-4-One, 1,5,6,7-Tetrahydro-2-(P-Methoxyphenyl)-1-Phenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C21H19NO2 |
| Molecular Weight | 317.39 |
| CAS Registry Number | 76410-25-8 |
| SMILES | C1=C([N](C2=C1C(CCC2)=O)C3=CC=CC=C3)C4=CC=C(C=C4)OC |
| InChI | 1S/C21H19NO2/c1-24-17-12-10-15(11-13-17)20-14-18-19(8-5-9-21(18)23)22(20)16-6-3-2-4-7-16/h2-4,6-7,10-14H,5,8-9H2,1H3 |
| InChIKey | WSRLDSHOMVODFC-UHFFFAOYSA-N |
| Density | 1.174g/cm3 (Cal.) |
|---|---|
| Boiling point | 536.861°C at 760 mmHg (Cal.) |
| Flash point | 278.484°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Methoxyphenyl)-1-Phenyl-6,7-Dihydro-5H-Indol-4-One |