|
CAS#: 76444-55-8 Product: 1-(2,4-Dihydroxy-6-Methoxy-3,5-Dimethylphenyl)-3-Phenylpropan-1-One No suppilers available for the product. |
| Name | 1-(2,4-Dihydroxy-6-Methoxy-3,5-Dimethylphenyl)-3-Phenylpropan-1-One |
|---|---|
| Synonyms | 1-(2,4-Dihydroxy-6-Methoxy-3,5-Dimethyl-Phenyl)-3-Phenyl-Propan-1-One; Acon1_001290; Angoletin |
| Molecular Structure | ![]() |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 |
| CAS Registry Number | 76444-55-8 |
| SMILES | C1=CC=CC=C1CCC(C2=C(C(=C(O)C(=C2OC)C)C)O)=O |
| InChI | 1S/C18H20O4/c1-11-16(20)12(2)18(22-3)15(17(11)21)14(19)10-9-13-7-5-4-6-8-13/h4-8,20-21H,9-10H2,1-3H3 |
| InChIKey | HBRYKWADRULLHU-UHFFFAOYSA-N |
| Density | 1.194g/cm3 (Cal.) |
|---|---|
| Boiling point | 491.638°C at 760 mmHg (Cal.) |
| Flash point | 177.738°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2,4-Dihydroxy-6-Methoxy-3,5-Dimethylphenyl)-3-Phenylpropan-1-One |