|
CAS#: 76467-68-0 Product: 4-(4-Amino-3-Methylphenyl)-2-Methylphenol No suppilers available for the product. |
| Name | 4-(4-Amino-3-Methylphenyl)-2-Methylphenol |
|---|---|
| Synonyms | 4-(4-Amino-3-Methyl-Phenyl)-2-Methyl-Phenol; (1,1'-Biphenyl)-4-Ol, 4'-Amino-3,3'-Dimethyl-; 4'-Amino-3,3'-Dimethyl-(1,1'-Biphenyl)-4-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 |
| CAS Registry Number | 76467-68-0 |
| SMILES | C1=C(C(=CC=C1C2=CC=C(N)C(=C2)C)O)C |
| InChI | 1S/C14H15NO/c1-9-7-11(3-5-13(9)15)12-4-6-14(16)10(2)8-12/h3-8,16H,15H2,1-2H3 |
| InChIKey | SXLCCDYUCUKEHK-UHFFFAOYSA-N |
| Density | 1.135g/cm3 (Cal.) |
|---|---|
| Boiling point | 355.987°C at 760 mmHg (Cal.) |
| Flash point | 169.095°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(4-Amino-3-Methylphenyl)-2-Methylphenol |