|
CAS#: 76500-09-9 Product: (2S)-5-Amino-2-[(3,4-Dihydroxyphenyl)-Methylamino]-5-Oxopentanoic Acid No suppilers available for the product. |
| Name | (2S)-5-Amino-2-[(3,4-Dihydroxyphenyl)-Methylamino]-5-Oxopentanoic Acid |
|---|---|
| Synonyms | (2S)-5-Amino-2-[(3,4-Dihydroxyphenyl)-Methyl-Amino]-5-Oxo-Pentanoic Acid; (2S)-5-Amino-2-[(3,4-Dihydroxyphenyl)-Methyl-Amino]-5-Keto-Valeric Acid; L-Glutamine, N-(3,4-Dihydroxyphenyl)-N(2)-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 |
| CAS Registry Number | 76500-09-9 |
| SMILES | [C@@H](N(C1=CC=C(O)C(=C1)O)C)(C(=O)O)CCC(=O)N |
| InChI | 1S/C12H16N2O5/c1-14(7-2-4-9(15)10(16)6-7)8(12(18)19)3-5-11(13)17/h2,4,6,8,15-16H,3,5H2,1H3,(H2,13,17)(H,18,19)/t8-/m0/s1 |
| InChIKey | DOACJPGLGGWIGS-QMMMGPOBSA-N |
| Density | 1.441g/cm3 (Cal.) |
|---|---|
| Boiling point | 663.984°C at 760 mmHg (Cal.) |
| Flash point | 355.365°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S)-5-Amino-2-[(3,4-Dihydroxyphenyl)-Methylamino]-5-Oxopentanoic Acid |