|
CAS#: 7654-03-7 Product: Benmoxine No suppilers available for the product. |
| Name | Benmoxine |
|---|---|
| Synonyms | Ncgc00160545-01; (Alpha-Methylbenzyl)-1-Benzoyl-2-Hydrazine; 1-(Benzoyl)-2-(Alpha-Methylbenzyl)Hydrazine |
| Molecular Structure | ![]() |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.30 |
| CAS Registry Number | 7654-03-7 |
| EINECS | 231-619-6 |
| SMILES | C2=C(C(NNC(C1=CC=CC=C1)=O)C)C=CC=C2 |
| InChI | 1S/C15H16N2O/c1-12(13-8-4-2-5-9-13)16-17-15(18)14-10-6-3-7-11-14/h2-12,16H,1H3,(H,17,18) |
| InChIKey | BEWNZPMDJIGBED-UHFFFAOYSA-N |
| Density | 1.11g/cm3 (Cal.) |
|---|---|
| Boiling point | 353.591°C at 760 mmHg (Cal.) |
| Flash point | 127.561°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Benmoxine |