|
CAS#: 76584-71-9 Product: 1,3,6,8-tetrabromo-dibenzo-dioxin No suppilers available for the product. |
| Name | 1,3,6,8-tetrabromo-dibenzo-dioxin |
|---|---|
| Synonyms | Dibenzo(B,E)(1,4)Dioxin, 1,3,6,8-Tetrabromo-; 1,3,6,8-Tetrabromo-Dibenzo-Dioxin |
| Molecular Structure | ![]() |
| Molecular Formula | C12H4Br4O2 |
| Molecular Weight | 499.78 |
| CAS Registry Number | 76584-71-9 |
| SMILES | C1=C(C=C2C(=C1Br)OC3=C(O2)C(=CC(=C3)Br)Br)Br |
| InChI | 1S/C12H4Br4O2/c13-5-1-7(15)11-9(3-5)18-12-8(16)2-6(14)4-10(12)17-11/h1-4H |
| InChIKey | FLEIILCTHUDZIV-UHFFFAOYSA-N |
| Density | 2.347g/cm3 (Cal.) |
|---|---|
| Boiling point | 459.186°C at 760 mmHg (Cal.) |
| Flash point | 191.151°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,6,8-tetrabromo-dibenzo-dioxin |