|
CAS#: 76668-05-8 Product: 2-[(4,5-Dichloro-1,3-Thiazol-2-Yl)Oxy]-N,N-Diethylacetamide No suppilers available for the product. |
| Name | 2-[(4,5-Dichloro-1,3-Thiazol-2-Yl)Oxy]-N,N-Diethylacetamide |
|---|---|
| Synonyms | 2-(4,5-Dichlorothiazol-2-Yl)Oxy-N,N-Diethyl-Acetamide; 2-[(4,5-Dichloro-2-Thiazolyl)Oxy]-N,N-Diethylacetamide; 2-[(4,5-Dichloro-1,3-Thiazol-2-Yl)Oxy]-N,N-Diethyl-Ethanamide |
| Molecular Structure | ![]() |
| Molecular Formula | C9H12Cl2N2O2S |
| Molecular Weight | 283.17 |
| CAS Registry Number | 76668-05-8 |
| EINECS | 278-522-5 |
| SMILES | C(OC1=NC(=C(Cl)S1)Cl)C(=O)N(CC)CC |
| InChI | 1S/C9H12Cl2N2O2S/c1-3-13(4-2)6(14)5-15-9-12-7(10)8(11)16-9/h3-5H2,1-2H3 |
| InChIKey | USKBGZTZMGJXMU-UHFFFAOYSA-N |
| Density | 1.368g/cm3 (Cal.) |
|---|---|
| Boiling point | 386.686°C at 760 mmHg (Cal.) |
| Flash point | 187.661°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(4,5-Dichloro-1,3-Thiazol-2-Yl)Oxy]-N,N-Diethylacetamide |