|
CAS#: 76702-27-7 Product: 1-[4-[4-(2,5-Dioxopyrrol-1-Yl)Benzoyl]Phenyl]Pyrrole-2,5-Dione No suppilers available for the product. |
| Name | 1-[4-[4-(2,5-Dioxopyrrol-1-Yl)Benzoyl]Phenyl]Pyrrole-2,5-Dione |
|---|---|
| Synonyms | 1-[4-[[4-(2,5-Dioxo-1-Pyrrolyl)Phenyl]-Oxomethyl]Phenyl]Pyrrole-2,5-Dione; 1-[4-(4-Maleimidobenzoyl)Phenyl]-3-Pyrroline-2,5-Quinone; 1-[4-[4-(2,5-Dioxopyrrol-1-Yl)Phenyl]Carbonylphenyl]Pyrrole-2,5-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C21H12N2O5 |
| Molecular Weight | 372.34 |
| CAS Registry Number | 76702-27-7 |
| SMILES | C1=CC(=CC=C1N2C(C=CC2=O)=O)C(=O)C3=CC=C(C=C3)N4C(C=CC4=O)=O |
| InChI | 1S/C21H12N2O5/c24-17-9-10-18(25)22(17)15-5-1-13(2-6-15)21(28)14-3-7-16(8-4-14)23-19(26)11-12-20(23)27/h1-12H |
| InChIKey | ORQOWEDKMXGKDJ-UHFFFAOYSA-N |
| Density | 1.494g/cm3 (Cal.) |
|---|---|
| Boiling point | 616.926°C at 760 mmHg (Cal.) |
| Flash point | 299.421°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[4-[4-(2,5-Dioxopyrrol-1-Yl)Benzoyl]Phenyl]Pyrrole-2,5-Dione |