|
CAS#: 76716-56-8 Product: 2-(Trichloromethyl)Benzoyl Chloride No suppilers available for the product. |
| Name | 2-(Trichloromethyl)Benzoyl Chloride |
|---|---|
| Synonyms | (Trichloromethyl)Benzoyl Chloride; Benzoyl Chloride, (Trichloromethyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C8H4Cl4O |
| Molecular Weight | 257.93 |
| CAS Registry Number | 76716-56-8 |
| EINECS | 257-891-6 |
| SMILES | C1=CC=CC(=C1C(Cl)(Cl)Cl)C(=O)Cl |
| InChI | 1S/C8H4Cl4O/c9-7(13)5-3-1-2-4-6(5)8(10,11)12/h1-4H |
| InChIKey | LJMNEQZBOODJQR-UHFFFAOYSA-N |
| Density | 1.543g/cm3 (Cal.) |
|---|---|
| Boiling point | 317.539°C at 760 mmHg (Cal.) |
| Flash point | 133.534°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Trichloromethyl)Benzoyl Chloride |