|
CAS#: 76759-26-7 Product: 2-Naphthylpyridine No suppilers available for the product. |
| Name | 2-Naphthylpyridine |
|---|---|
| Synonyms | 2-(2-Naphthyl)Pyridine; 2-Naphthylpyridine |
| Molecular Structure | ![]() |
| Molecular Formula | C15H11N |
| Molecular Weight | 205.26 |
| CAS Registry Number | 76759-26-7 |
| EINECS | 278-544-5 |
| SMILES | C2=C(C1=NC=CC=C1)C=CC3=C2C=CC=C3 |
| InChI | 1S/C15H11N/c1-2-6-13-11-14(9-8-12(13)5-1)15-7-3-4-10-16-15/h1-11H |
| InChIKey | DBENTMPUKROOOE-UHFFFAOYSA-N |
| Density | 1.127g/cm3 (Cal.) |
|---|---|
| Boiling point | 361.197°C at 760 mmHg (Cal.) |
| Flash point | 159.827°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Naphthylpyridine |