|
CAS#: 76777-25-8 Product: 1,2,3,4,5,6-Hexahydro-1,6-Methano-2-Benzazocine Hydrochloride No suppilers available for the product. |
| Name | 1,2,3,4,5,6-Hexahydro-1,6-Methano-2-Benzazocine Hydrochloride |
|---|---|
| Synonyms | 1,6-Methano-2-Benzazocine, 1,2,3,4,5,6-Hexahydro-, Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16ClN |
| Molecular Weight | 209.72 |
| CAS Registry Number | 76777-25-8 |
| SMILES | [H+].C1=CC=CC2=C1C3NCCCC2C3.[Cl-] |
| InChI | 1S/C12H15N.ClH/c1-2-6-11-10(5-1)9-4-3-7-13-12(11)8-9;/h1-2,5-6,9,12-13H,3-4,7-8H2;1H |
| InChIKey | FHZJPYCXPONQRW-UHFFFAOYSA-N |
| Boiling point | 285.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 132.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4,5,6-Hexahydro-1,6-Methano-2-Benzazocine Hydrochloride |