|
CAS#: 76783-35-2 Product: Diphenylmethyl 5-oxo-L-prolinate No suppilers available for the product. |
| Name | Diphenylmethyl 5-oxo-L-prolinate |
|---|---|
| Synonyms | benzhydryl 5-oxo-L-prolinate |
| Molecular Structure | ![]() |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.33 |
| CAS Registry Number | 76783-35-2 |
| EINECS | 278-548-7 |
| SMILES | O=C(OC(c1ccccc1)c2ccccc2)[C@@H]3CCC(=O)N3 |
| InChI | 1S/C18H17NO3/c20-16-12-11-15(19-16)18(21)22-17(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15,17H,11-12H2,(H,19,20)/t15-/m0/s1 |
| InChIKey | PEVMOWGDBVQWCM-HNNXBMFYSA-N |
| Density | 1.213g/cm3 (Cal.) |
|---|---|
| Boiling point | 492.146°C at 760 mmHg (Cal.) |
| Flash point | 251.441°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diphenylmethyl 5-oxo-L-prolinate |