|
CAS#: 7681-79-0 Product: etafedrine No suppilers available for the product. |
| Name | etafedrine |
|---|---|
| Synonyms | 2-(Ethyl-Methyl-Amino)-1-Phenyl-Propan-1-Ol Hydrochloride; Nethamine; Benzenemethanol, Alpha-(1-(Ethylmethylamino)Ethyl)-, Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C12H20ClNO |
| Molecular Weight | 229.75 |
| CAS Registry Number | 7681-79-0 |
| EINECS | 231-677-2 |
| SMILES | [H+].C1=C(C(O)C(N(CC)C)C)C=CC=C1.[Cl-] |
| InChI | 1S/C12H19NO.ClH/c1-4-13(3)10(2)12(14)11-8-6-5-7-9-11;/h5-10,12,14H,4H2,1-3H3;1H |
| InChIKey | WRONACHIHQGZSD-UHFFFAOYSA-N |
| Boiling point | 294.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 104.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for etafedrine |