|
CAS#: 76840-12-5 Product: Chloro-(3,4,5,6-tetrachloropyridin-2-yl)methanamine No suppilers available for the product. |
| Name | Chloro-(3,4,5,6-tetrachloropyridin-2-yl)methanamine |
|---|---|
| Synonyms | Chloro-(3,4,5,6-Tetrachloro-2-Pyridyl)Methanamine; [Chloro-(3,4,5,6-Tetrachloro-2-Pyridyl)Methyl]Amine; Aminopentachloro-2-Picoline |
| Molecular Structure | ![]() |
| Molecular Formula | C6H3Cl5N2 |
| Molecular Weight | 280.37 |
| CAS Registry Number | 76840-12-5 |
| SMILES | C1(=NC(=C(C(=C1Cl)Cl)Cl)Cl)C(Cl)N |
| InChI | 1S/C6H3Cl5N2/c7-1-2(8)4(5(10)12)13-6(11)3(1)9/h5H,12H2 |
| InChIKey | MZTGXJCZRHTRJZ-UHFFFAOYSA-N |
| Density | 1.724g/cm3 (Cal.) |
|---|---|
| Boiling point | 309.984°C at 760 mmHg (Cal.) |
| Flash point | 141.273°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Chloro-(3,4,5,6-tetrachloropyridin-2-yl)methanamine |