|
CAS#: 7685-70-3 Product: N-[(O-Nitrophenyl)Thio]-L-Threonine No suppilers available for the product. |
| Name | N-[(O-Nitrophenyl)Thio]-L-Threonine |
|---|---|
| Synonyms | (2S,3R)-3-Hydroxy-2-[[(2-Nitrophenyl)Thio]Amino]Butanoic Acid; (2S,3R)-3-Hydroxy-2-[[(2-Nitrophenyl)Thio]Amino]Butyric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12N2O5S |
| Molecular Weight | 272.28 |
| CAS Registry Number | 7685-70-3 |
| EINECS | 231-692-4 |
| SMILES | [C@@H](NSC1=C([N+]([O-])=O)C=CC=C1)(C(=O)O)[C@H](O)C |
| InChI | 1S/C10H12N2O5S/c1-6(13)9(10(14)15)11-18-8-5-3-2-4-7(8)12(16)17/h2-6,9,11,13H,1H3,(H,14,15)/t6-,9+/m1/s1 |
| InChIKey | QJMPRIHAPGGFMA-MUWHJKNJSA-N |
| Density | 1.49g/cm3 (Cal.) |
|---|---|
| Boiling point | 493.792°C at 760 mmHg (Cal.) |
| Flash point | 252.437°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[(O-Nitrophenyl)Thio]-L-Threonine |