Online Database of Chemicals from Around the World
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (650) 278-9963 | |||
 |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | N2-[(2-Nitrophenyl)sulfanyl]-L-glutamine |
|---|---|
| Synonyms | N-O-NPS-L-GLUTAMINE |
| Molecular Structure | ![CAS#: 7685-73-6, N<sup>2</sup>-[(2-Nitrophenyl)sulfanyl]-L-glutamine](/moreStructures/7685-73-6.gif) |
| Molecular Formula | C11H13N3O5S |
| Molecular Weight | 299.30 |
| CAS Registry Number | 7685-73-6 |
| SMILES | [O-][N+](=O)c1ccccc1SN[C@H](C(=O)O)CCC(=O)N |
| InChI | 1S/C11H13N3O5S/c12-10(15)6-5-7(11(16)17)13-20-9-4-2-1-3-8(9)14(18)19/h1-4,7,13H,5-6H2,(H2,12,15)(H,16,17)/t7-/m0/s1 |
| InChIKey | NBRYAVKKYCYBRR-ZETCQYMHSA-N |
| Density | 1.485g/cm3 (Cal.) |
|---|---|
| Boiling point | 615.905°C at 760 mmHg (Cal.) |
| Flash point | 326.288°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N2-[(2-Nitrophenyl)sulfanyl]-L-glutamine |