|
CAS#: 7688-64-4 Product: O-Acetylcamptothecin No suppilers available for the product. |
| Name | O-Acetylcamptothecin |
|---|---|
| Synonyms | 4-Ethyl-3,14-Dioxo-3,4,12,14-Tetrahydro-1H-Pyrano[3',4':6,7]Indolizino[1,2-B]Quinolin-4-Yl Acetate; Nci60_042119; (S)-4-(Acetyloxy)4-Ethyl-1H-Pyrano(3',4':6,7)Indolizino(1,2-B)Quinoline-3,14(4H,12H)-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C22H18N2O5 |
| Molecular Weight | 390.39 |
| CAS Registry Number | 7688-64-4 |
| SMILES | C4=C3CN1C(=CC2=C(C1=O)COC(C2(OC(=O)C)CC)=O)C3=NC5=CC=CC=C45 |
| InChI | 1S/C22H18N2O5/c1-3-22(29-12(2)25)16-9-18-19-14(8-13-6-4-5-7-17(13)23-19)10-24(18)20(26)15(16)11-28-21(22)27/h4-9H,3,10-11H2,1-2H3 |
| InChIKey | ASVIEXKOXDCZDF-UHFFFAOYSA-N |
| Density | 1.456g/cm3 (Cal.) |
|---|---|
| Boiling point | 740.964°C at 760 mmHg (Cal.) |
| Flash point | 401.921°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for O-Acetylcamptothecin |