|
CAS#: 769160-80-7 Product: 2-[2-Ethoxy-4-(hydroxymethyl)-6-iodophenoxy]-N-(4-fluorophenyl)acetamide No suppilers available for the product. |
| Name | 2-[2-Ethoxy-4-(hydroxymethyl)-6-iodophenoxy]-N-(4-fluorophenyl)acetamide |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C17H17FINO4 |
| Molecular Weight | 445.22 |
| CAS Registry Number | 769160-80-7 |
| SMILES | CCOc1cc(cc(c1OCC(=O)Nc2ccc(cc2)F)I)CO |
| InChI | 1S/C17H17FINO4/c1-2-23-15-8-11(9-21)7-14(19)17(15)24-10-16(22)20-13-5-3-12(18)4-6-13/h3-8,21H,2,9-10H2,1H3,(H,20,22) |
| InChIKey | CSBWJCAVZKNPFN-UHFFFAOYSA-N |
| Density | 1.64g/cm3 (Cal.) |
|---|---|
| Boiling point | 609.324°C at 760 mmHg (Cal.) |
| Flash point | 322.308°C (Cal.) |
| Refractive index | 1.637 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[2-Ethoxy-4-(hydroxymethyl)-6-iodophenoxy]-N-(4-fluorophenyl)acetamide |