|
CAS#: 7696-00-6 Product: Mitotenamine No suppilers available for the product. |
| Name | Mitotenamine |
|---|---|
| Synonyms | N-[(5-Bromobenzothiophen-3-Yl)Methyl]-2-Chloro-N-Ethyl-Ethanamine; N-[(5-Bromo-3-Benzothiophenyl)Methyl]-2-Chloro-N-Ethylethanamine; (5-Bromobenzothiophen-3-Yl)Methyl-(2-Chloroethyl)-Ethyl-Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15BrClNS |
| Molecular Weight | 332.69 |
| CAS Registry Number | 7696-00-6 |
| SMILES | C1=C(Br)C=CC2=C1C(=CS2)CN(CCCl)CC |
| InChI | 1S/C13H15BrClNS/c1-2-16(6-5-15)8-10-9-17-13-4-3-11(14)7-12(10)13/h3-4,7,9H,2,5-6,8H2,1H3 |
| InChIKey | SZLHBBCRNVPTRZ-UHFFFAOYSA-N |
| Density | 1.445g/cm3 (Cal.) |
|---|---|
| Boiling point | 368.518°C at 760 mmHg (Cal.) |
| Flash point | 176.674°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Mitotenamine |