|
CAS#: 7698-97-7 Product: Fenestrel No suppilers available for the product. |
| Name | Fenestrel |
|---|---|
| Synonyms | Sodium 5-Ethyl-6-Methyl-4-Phenyl-Cyclohex-3-Ene-1-Carboxylate; Sodium 5-Ethyl-6-Methyl-4-Phenyl-1-Cyclohex-3-Enecarboxylate; 2-Methyl-3-Ethyl-4-Phenyl-Delta(Sup 4)-Cyclohexene Carboxylic Acid Sodium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C16H19NaO2 |
| Molecular Weight | 266.31 |
| CAS Registry Number | 7698-97-7 (16550-39-3) |
| SMILES | C2=C(C1=CCC(C(C1CC)C)C([O-])=O)C=CC=C2.[Na+] |
| InChI | 1S/C16H20O2.Na/c1-3-13-11(2)14(16(17)18)9-10-15(13)12-7-5-4-6-8-12;/h4-8,10-11,13-14H,3,9H2,1-2H3,(H,17,18);/q;+1/p-1 |
| InChIKey | PIFVVPYZGHCUTH-UHFFFAOYSA-M |
| Boiling point | 389.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 183.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Fenestrel |