|
CAS#: 770-95-6 Product: Trichloro(2-Chloro-2,3,3-Trifluorocyclobutyl)Silane No suppilers available for the product. |
| Name | Trichloro(2-Chloro-2,3,3-Trifluorocyclobutyl)Silane |
|---|---|
| Synonyms | Trichloro-(2-Chloro-2,3,3-Trifluoro-Cyclobutyl)Silane; (2,3,3-Trifluoro-2-Chlorocyclobutyl)Trichlorosilane |
| Molecular Structure | ![]() |
| Molecular Formula | C4H3Cl4F3Si |
| Molecular Weight | 277.96 |
| CAS Registry Number | 770-95-6 |
| EINECS | 212-226-9 |
| SMILES | C1C([Si](Cl)(Cl)Cl)C(C1(F)F)(Cl)F |
| InChI | 1S/C4H3Cl4F3Si/c5-4(11)2(12(6,7)8)1-3(4,9)10/h2H,1H2 |
| InChIKey | VDQCXADBEMNEGF-UHFFFAOYSA-N |
| Density | 1.583g/cm3 (Cal.) |
|---|---|
| Boiling point | 194.324°C at 760 mmHg (Cal.) |
| Flash point | 71.325°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trichloro(2-Chloro-2,3,3-Trifluorocyclobutyl)Silane |