|
CAS#: 77061-50-8 Product: 6-Amino-7-bromonaphtho[2,3-c]acridine-5,8,14(13H)-trione No suppilers available for the product. |
| Name | 6-Amino-7-bromonaphtho[2,3-c]acridine-5,8,14(13H)-trione |
|---|---|
| Synonyms | 6-amino-7-bromonaphth[2,3-c]acridine-5,8,14(13H)-trione |
| Molecular Structure | ![]() |
| Molecular Formula | C21H11BrN2O3 |
| Molecular Weight | 419.23 |
| CAS Registry Number | 77061-50-8 |
| EINECS | 278-600-9 |
| SMILES | Brc2c1C(=O)c5ccccc5Nc1c4c(c2N)C(=O)c3ccccc3C4=O |
| InChI | 1S/C21H11BrN2O3/c22-16-15-18(24-12-8-4-3-7-11(12)21(15)27)14-13(17(16)23)19(25)9-5-1-2-6-10(9)20(14)26/h1-8H,23H2,(H,24,27) |
| InChIKey | CGUVQSVASMLCTI-UHFFFAOYSA-N |
| Density | 1.699g/cm3 (Cal.) |
|---|---|
| Boiling point | 708.954°C at 760 mmHg (Cal.) |
| Flash point | 382.562°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Amino-7-bromonaphtho[2,3-c]acridine-5,8,14(13H)-trione |