|
CAS#: 771-40-4 Product: 2-Methyl-4H-1-Benzothiopyran-4-One No suppilers available for the product. |
| Name | 2-Methyl-4H-1-Benzothiopyran-4-One |
|---|---|
| Synonyms | 2-Methyl-4-Thiochromenone; Zinc00237890; 2-Methyl-4H-Thiochromen-4-One |
| Molecular Structure | ![]() |
| Molecular Formula | C10H8OS |
| Molecular Weight | 176.23 |
| CAS Registry Number | 771-40-4 |
| SMILES | C1=CC=CC2=C1C(=O)C=C(S2)C |
| InChI | 1S/C10H8OS/c1-7-6-9(11)8-4-2-3-5-10(8)12-7/h2-6H,1H3 |
| InChIKey | MGMTVGPDPYFNAU-UHFFFAOYSA-N |
| Density | 1.228g/cm3 (Cal.) |
|---|---|
| Boiling point | 276.655°C at 760 mmHg (Cal.) |
| Flash point | 136.055°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-4H-1-Benzothiopyran-4-One |