Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054//+86 13424336463 | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-[(4-hydroxy-3,5-dimethyl-phenyl)methyl]propanedinitrile |
|---|---|
| Synonyms | 2-(4-hydroxy-3,5-dimethylbenzyl)malononitrile |
| Molecular Structure | ![CAS#: 771559-47-8, 2-[(4-hydroxy-3,5-dimethyl-phenyl)methyl]propanedinitrile](/moreStructures/771559-47-8.gif) |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 |
| CAS Registry Number | 771559-47-8 |
| SMILES | Cc1cc(CC(C#N)C#N)cc(C)c1O |
| InChI | 1S/C12H12N2O/c1-8-3-10(4-9(2)12(8)15)5-11(6-13)7-14/h3-4,11,15H,5H2,1-2H3 |
| InChIKey | AJDLZQGKTTVBMG-UHFFFAOYSA-N |
| Density | 1.155g/cm3 (Cal.) |
|---|---|
| Boiling point | 418.55°C at 760 mmHg (Cal.) |
| Flash point | 206.932°C (Cal.) |
| Refractive index | 1.563 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(4-hydroxy-3,5-dimethyl-phenyl)methyl]propanedinitrile |