|
CAS#: 7716-59-8 Product: N-Ethyl-1,2-Benzisothiazol-3-Amine Monohydrochloride No suppilers available for the product. |
| Name | N-Ethyl-1,2-Benzisothiazol-3-Amine Monohydrochloride |
|---|---|
| Synonyms | 1,2-Benzothiazol-3-Yl-Ethyl-Amine Hydrochloride; N-Ethyl-1,2-Benzisothiazol-3-Amine Monohydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C9H11ClN2S |
| Molecular Weight | 214.71 |
| CAS Registry Number | 7716-59-8 |
| EINECS | 231-738-3 |
| SMILES | [H+].C1=CC=CC2=C1C(=NS2)NCC.[Cl-] |
| InChI | 1S/C9H10N2S.ClH/c1-2-10-9-7-5-3-4-6-8(7)12-11-9;/h3-6H,2H2,1H3,(H,10,11);1H |
| InChIKey | SZWACMABFMCJPV-UHFFFAOYSA-N |
| Boiling point | 242.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 100.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Ethyl-1,2-Benzisothiazol-3-Amine Monohydrochloride |