|
CAS#: 772300-86-4 Product: 4-(3-Aminobicyclo[2.2.1]hept-2-yl)-1,2-benzenediol No suppilers available for the product. |
| Name | 4-(3-Aminobicyclo[2.2.1]hept-2-yl)-1,2-benzenediol |
|---|---|
| Synonyms | 4-(3-aminobicyclo[2.2.1]heptan-2-yl)benzene-1,2-diol |
| Molecular Structure | ![]() |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 |
| CAS Registry Number | 772300-86-4 |
| SMILES | C1CC2CC1C(C2N)C3=CC(=C(C=C3)O)O |
| InChI | 1S/C13H17NO2/c14-13-9-2-1-7(5-9)12(13)8-3-4-10(15)11(16)6-8/h3-4,6-7,9,12-13,15-16H,1-2,5,14H2 |
| InChIKey | BOYRAZQGPLFKSR-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 400.6±45.0°C at 760 mmHg (Cal.) |
| Flash point | 196.1±28.7°C (Cal.) |
| Refractive index | 1.633 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(3-Aminobicyclo[2.2.1]hept-2-yl)-1,2-benzenediol |